5-Amino-1-naphthol-3-sulfonic Acid structure
|
Common Name | 5-Amino-1-naphthol-3-sulfonic Acid | ||
|---|---|---|---|---|
| CAS Number | 489-78-1 | Molecular Weight | 239.24800 | |
| Density | 0.5879 | Boiling Point | −6.9 °C(lit.) | |
| Molecular Formula | C10H9NO4S | Melting Point | −140 °C | |
| MSDS | N/A | Flash Point | -80 °C | |
| Name | 5-Amino-1-naphthol-3-sulfonic Acid Hydrate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.5879 |
|---|---|
| Boiling Point | −6.9 °C(lit.) |
| Melting Point | −140 °C |
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.24800 |
| Flash Point | -80 °C |
| Exact Mass | 239.02500 |
| PSA | 109.00000 |
| LogP | 3.03630 |
| Vapour density | 2 (vs air) |
| Index of Refraction | 1.3811 |
| InChIKey | GGZZISOUXJHYOY-UHFFFAOYSA-N |
| SMILES | Nc1cccc2c(O)cc(S(=O)(=O)O)cc12 |
| Freezing Point | -140.34℃ |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00035712 |
| EINECS 207-700-7 |
| M Acid Hydrate |
| 5-Amino-1-naphthol-3-sulfonic Acid |
| 8-Amino-4-hydroxy-2-naphthalenesulfonic Acid Hydrate |
| 8-amino-4-hydroxynaphthalene-2-sulfonic acid |