1-naphthylamine-5-sulfonic acid structure
|
Common Name | 1-naphthylamine-5-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 84-89-9 | Molecular Weight | 223.248 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO3S | Melting Point | >300°C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 5-Aminonaphthalene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Melting Point | >300°C |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.248 |
| Exact Mass | 223.030319 |
| PSA | 88.77000 |
| LogP | 0.42 |
| Index of Refraction | 1.713 |
| InChIKey | DQNAQOYOSRJXFZ-UHFFFAOYSA-N |
| SMILES | Nc1cccc2c(S(=O)(=O)O)cccc12 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H312-H314-H332 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R20/21/22;R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 2585 8/PG 3 |
| WGK Germany | 3 |
| RTECS | QK1270500 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2921450090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2921450090 |
|---|---|
| Summary | 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Identification of a novel ligand binding motif in the transthyretin channel.
Bioorg. Med. Chem. 18 , 100-10, (2010) The design of therapeutic compounds targeting transthyretin (TTR) is challenging due to the low specificity of interaction in the hormone binding site. Such feature is highlighted by the interactions ... |
|
|
[An interesting peroxidase staining.--utilization of blended substrate of mixed 2, 7-FDA and Laurent's acid-- (author's transl)].
Rinsho Byori. 29(6) , 613-6, (1981)
|
|
|
Evidence for a ppGpp-binding site on Escherichia coli RNA polymerase: proximity relationship with the rifampicin-binding domain.
Mol. Microbiol. 15(2) , 255-65, (1995) On amino acid starvation, Escherichia coli cells exhibit an adaptive facility termed the stringent response. This is characterized by the production of high levels of a regulatory nucleotide, ppGpp, a... |
| 1-naphthylamine-5-sulfonic acid |
| 5-Amino-1-naphthalenesulfonic acid |
| 5-Aminonaphthalene-1-sulfonic acid |
| MFCD00014315 |
| 1-Naphthalenesulfonic acid, 5-amino- |
| EINECS 201-571-0 |