2-methoxy-1-nitro-naphthalene structure
|
Common Name | 2-methoxy-1-nitro-naphthalene | ||
|---|---|---|---|---|
| CAS Number | 4900-66-7 | Molecular Weight | 203.19400 | |
| Density | 1.274g/cm3 | Boiling Point | 357.7ºC at 760 mmHg | |
| Molecular Formula | C11H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.1ºC | |
| Name | 2-methoxy-1-nitronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 357.7ºC at 760 mmHg |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.19400 |
| Flash Point | 172.1ºC |
| Exact Mass | 203.05800 |
| PSA | 55.05000 |
| LogP | 3.27980 |
| Index of Refraction | 1.638 |
| InChIKey | XDNSKIDXVJNJFO-UHFFFAOYSA-N |
| SMILES | COc1ccc2ccccc2c1[N+](=O)[O-] |
| HS Code | 2909309090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Naphthalene,2-methoxy-1-nitro |
| 2-methoxy-1-nitro-naphthalene |
| 1-Nitro-2-methoxy-naphthalin |
| 1-nitro-2-methoxynaphthalene |
| methyl-(1-nitro-[2]naphthyl)-ether |
| EINECS 225-529-6 |
| Methyl-(1-nitro-[2]naphthyl)-aether |