4-(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2,6-dimethylcyclohexa-2,5-dien-1-one structure
|
Common Name | 4-(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2,6-dimethylcyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 4906-22-3 | Molecular Weight | 240.29700 | |
| Density | 1.123g/cm3 | Boiling Point | 375.1ºC at 760 mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | 205-207ºC | |
| MSDS | N/A | Flash Point | 140.7ºC | |
| Name | 4-(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2,6-dimethylcyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.123g/cm3 |
|---|---|
| Boiling Point | 375.1ºC at 760 mmHg |
| Melting Point | 205-207ºC |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.29700 |
| Flash Point | 140.7ºC |
| Exact Mass | 240.11500 |
| PSA | 34.14000 |
| LogP | 3.23360 |
| Index of Refraction | 1.572 |
| InChIKey | QDRFIDSUGRGGAY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C)C(=O)C(C)=C2)C=C(C)C1=O |
| HS Code | 2914299000 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914299000 |
|---|---|
| Summary | 2914299000. other cyclanic, cyclenic or cyclotherpenic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 3,5,3',5'-tetramethyl-4,4'-diphenoquinone |
| (Bi-2,5-cyclohexadien-1-ylidene)-4,4'-dione,3,3',5,5'-tetramethyl |
| Tetramethyldiphenoquinone |
| 3,3',5,5'-Tetramethyldiphenoquinone |
| 2,6,2',6'-tetramethyldiphenoquinone |
| 3,3',5,5'-tetramethyl-1,1'-bi(cyclohexa-2,5-dien-1-ylidene)-4,4'-dione |
| 3,3',5,5'-tetramethyl-1,4-diphenoquinone |
| 3,3',5,5'-Tetramethyl-4,4'-diphenoquinone |
| 2,5-Cyclohexadien-1-one,4-(3,5-dimethyl-4-oxo-2,5-cyclohexadien-1-ylidene)-2,6-dimethyl |
| 4-(3,5-dimethyl-4-oxo-2,5-cyclohexadienylidene)-2,6-dimethyl-2,5-cyclohexadienone |