2,4-Dimethoxy-1-nitrobenzene structure
|
Common Name | 2,4-Dimethoxy-1-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 4920-84-7 | Molecular Weight | 183.16100 | |
| Density | 1.226g/cm3 | Boiling Point | 317.9ºC at 760mmHg | |
| Molecular Formula | C8H9NO4 | Melting Point | 72-76 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 156.7ºC | |
| Name | 2,4-Dimethoxy-1-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 317.9ºC at 760mmHg |
| Melting Point | 72-76 °C(lit.) |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16100 |
| Flash Point | 156.7ºC |
| Exact Mass | 183.05300 |
| PSA | 64.28000 |
| LogP | 2.13520 |
| Index of Refraction | 1.53 |
| InChIKey | XXWIYOBCHKCWNT-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c(OC)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S24/25-S22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2909309090 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Degradation of 2,4-dinitrotoluene by the lignin-degrading fungus Phanerochaete chrysosporium.
Appl. Environ. Microbiol. 58(1) , 221-8, (1992) Under ligninolytic conditions, the white rot basidiomycete Phanerochaete chrysosporium mineralizes 2,4-dinitrotoluene (I). The pathway for the degradation of I was elucidated by the characterization o... |
| EINECS 225-551-6 |
| 2,4-Dimethoxy-1-Nitrobenzene |
| 4-Nitroresorcinol dimethyl ether |
| 2,4-diMethoxylnitrobenzene |
| 1,3-Dimethoxy-4-nitrobenzene |
| MFCD00024210 |
| 3-methoxy-4-nitroanisole |
| 2,4-dimethoxynitrobenzene |
| 2,4,7,8,9-PENTA-O-ACETYL N-ACETYLNEURAMINIC ACID |
| 4-nitro-1,3-dimethoxybenzene |