Sodium gentisate structure
|
Common Name | Sodium gentisate | ||
|---|---|---|---|---|
| CAS Number | 4955-90-2 | Molecular Weight | 176.102 | |
| Density | N/A | Boiling Point | 406.9ºC at 760 mmHg | |
| Molecular Formula | C7H5NaO4 | Melting Point | >220ºC (dec) | |
| MSDS | USA | Flash Point | 214ºC | |
| Name | Gentisic Acid Sodium Salt Hydrate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 406.9ºC at 760 mmHg |
|---|---|
| Melting Point | >220ºC (dec) |
| Molecular Formula | C7H5NaO4 |
| Molecular Weight | 176.102 |
| Flash Point | 214ºC |
| Exact Mass | 176.008560 |
| PSA | 80.59000 |
| InChIKey | MOIJZWWOFOQFMH-UHFFFAOYSA-M |
| SMILES | O=C([O-])c1cc(O)ccc1O.[Na+] |
| Storage condition | -20?C Freezer |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | LY3860000 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
|
5-Amino-1-naphthol, a novel 1,5-naphthalene derivative matrix suitable for matrix-assisted laser desorption/ionization in-source decay of phosphorylated peptides.
Rapid Commun. Mass Spectrom. 27(1) , 103-8, (2013) Although matrix-assisted laser desorption/ionization in-source decay (MALDI-ISD) is an important method for post-translational modification (PTM) analysis, the conventional matrices, 2,5-dihydroxybenz... |
|
|
Quantitative imaging of a therapeutic peptide in biological tissue sections by MALDI MS.
Bioanalysis 5(5) , 603-12, (2013) Therapeutic peptides and proteins are being increasingly explored as potential therapeutic agents for molecular-targeted therapy, and the requirement for quantitative bioanalytical tools for such mole... |
|
|
Siderocalin/Lcn2/NGAL/24p3 does not drive apoptosis through gentisic acid mediated iron withdrawal in hematopoietic cell lines.
PLoS ONE 7(8) , e43696, (2012) Siderocalin (also lipocalin 2, NGAL or 24p3) binds iron as complexes with specific siderophores, which are low molecular weight, ferric ion-specific chelators. In innate immunity, siderocalin slows th... |
| KAD 3213 |
| [3H]-Silodosin |
| EINECS 225-598-2 |
| [14C]-Silodosin |
| UNII-CUZ39LUY82 |
| MFCD00016504 |
| Urief |
| 1-(3-Hydroxypropyl)-5-[(2R)-2-({2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl}amino)propyl]-7-indolinecarboxamide |
| 1-(3-hydroxypropyl)-5-[(2R)-2-({2-[2-(2,2,2-trifluoroethoxy)phenoxy]ethyl}amino)propyl]-2,3-dihydro-1H-indole-7-carboxamide |
| Rapaflo |
| Silodyx |
| Silodosin |
| KMD-3213 |