2-(4-chloro-2-butenyl)-1,3-isoindolinedione structure
|
Common Name | 2-(4-chloro-2-butenyl)-1,3-isoindolinedione | ||
|---|---|---|---|---|
| CAS Number | 49705-66-0 | Molecular Weight | 235.66600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chloro-2-butenyl)-1,3-isoindolinedione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10ClNO2 |
|---|---|
| Molecular Weight | 235.66600 |
| Exact Mass | 235.04000 |
| PSA | 37.38000 |
| LogP | 2.01550 |
| InChIKey | VSGHWUAHVBTJIU-ONEGZZNKSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CC=CCCl |
|
~73%
2-(4-chloro-2-b... CAS#:49705-66-0 |
| Literature: Gov't of the USA as represented by The Secretary of the Department of Health and Human Services Patent: US2006/106030 A1, 2006 ; Location in patent: Page/Page column 4 ; US 20060106030 A1 |
|
~49%
2-(4-chloro-2-b... CAS#:49705-66-0 |
| Literature: Taiho Pharmaceutical Co. Ltd. Patent: US5401739 A1, 1995 ; |
|
~38%
2-(4-chloro-2-b... CAS#:49705-66-0 |
| Literature: PHARMACIA CORPORATION Patent: WO2005/25620 A2, 2005 ; Location in patent: Page/Page column 129 ; WO 2005/025620 A2 |
|
~%
2-(4-chloro-2-b... CAS#:49705-66-0 |
| Literature: Bojarski, Andrzej J.; Duszynska, Beata; Kolaczkowski, Marcin; Kowalski, Piotr; Kowalska, Teresa Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 23 p. 5863 - 5866 |
| trans-2-(4-chloro-2-butenyl)-1H-isoindole-1,3(2H)-dione |
| (E)-1-chloro-4-(N-phthalimido)-2-butene |
| trans-1-chloro-4-phthalimido-2-butene |
| N-[4-chloro(trans)-2-butenyl]phthalimide |
| N-(4-chloro-2-butenyl)isoindole-1,3(2H)-dione |
| (E)-2-(4-chloro-2-buten-1-yl)-1H-isoindole-1,3(2H)-dione |
| TRANS-N-(4-CHLOROBUTENYL) PHTHALIMIDE |