1,4-Naphthalenedione,2-(3-methylbutyl)- structure
|
Common Name | 1,4-Naphthalenedione,2-(3-methylbutyl)- | ||
|---|---|---|---|---|
| CAS Number | 49802-40-6 | Molecular Weight | 228.28600 | |
| Density | 1.097g/cm3 | Boiling Point | 352.5ºC at 760mmHg | |
| Molecular Formula | C15H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.3ºC | |
| Name | 2-(3-methylbutyl)naphthalene-1,4-dione |
|---|
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 352.5ºC at 760mmHg |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.28600 |
| Flash Point | 132.3ºC |
| Exact Mass | 228.11500 |
| PSA | 34.14000 |
| LogP | 3.42820 |
| Index of Refraction | 1.548 |
| InChIKey | LTDXMRHTAVBPHX-UHFFFAOYSA-N |
| SMILES | CC(C)CCC1=CC(=O)c2ccccc2C1=O |
|
~%
1,4-Naphthalene... CAS#:49802-40-6 |
| Literature: Fieser et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 3177 |
|
~%
1,4-Naphthalene... CAS#:49802-40-6 |
| Literature: Ziegler Patent: US2480072 , 1946 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |