2-Chloro-6-ethylquinoline-3-carbonitrile structure
|
Common Name | 2-Chloro-6-ethylquinoline-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 498548-90-6 | Molecular Weight | 216.66600 | |
| Density | 1.26g/cm3 | Boiling Point | 381ºC at 760 mmHg | |
| Molecular Formula | C12H9ClN2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 184.2ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2-Chloro-6-ethylquinoline-3-carbonitrile |
|---|
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 381ºC at 760 mmHg |
| Molecular Formula | C12H9ClN2 |
| Molecular Weight | 216.66600 |
| Flash Point | 184.2ºC |
| Exact Mass | 216.04500 |
| PSA | 36.68000 |
| LogP | 3.32228 |
| Index of Refraction | 1.63 |
| InChIKey | ZZBSVGBZSYQFSD-UHFFFAOYSA-N |
| SMILES | CCc1ccc2nc(Cl)c(C#N)cc2c1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |