A 1899 structure
|
Common Name | A 1899 | ||
|---|---|---|---|---|
| CAS Number | 498577-46-1 | Molecular Weight | 500.536 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 756.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C30H26F2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 411.3±32.9 °C | |
Use of A 1899A1899 is a potent and selective TASK-1 and TASK-3 antagonist. |
| Name | N-(2,4-Difluorobenzyl)-2'-({[(4-methoxyphenyl)acetyl]amino}methyl)-2-biphenylcarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 756.5±60.0 °C at 760 mmHg |
| Molecular Formula | C30H26F2N2O3 |
| Molecular Weight | 500.536 |
| Flash Point | 411.3±32.9 °C |
| Exact Mass | 500.191162 |
| LogP | 4.60 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | IXKPEYHRIVQTCU-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(=O)NCc2ccccc2-c2ccccc2C(=O)NCc2ccc(F)cc2F)cc1 |
| N-(2,4-Difluorobenzyl)-2'-({[(4-methoxyphenyl)acetyl]amino}methyl)-2-biphenylcarboxamide |
| N-(2,4-difluorobenzyl)-2'-({[(4-methoxyphenyl)acetyl]amino}methyl)biphenyl-2-carboxamide |
| Benzeneacetamide, N-[[2'-[[[(2,4-difluorophenyl)methyl]amino]carbonyl][1,1'-biphenyl]-2-yl]methyl]-4-methoxy- |
| MFCD06407754 |