Demethoxydeacetoxypseudolaric acid B analog structure
|
Common Name | Demethoxydeacetoxypseudolaric acid B analog | ||
|---|---|---|---|---|
| CAS Number | 500736-17-4 | Molecular Weight | 376.400 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 665.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H30O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.2±25.0 °C | |
Use of Demethoxydeacetoxypseudolaric acid B analogDemethoxydeacetoxypseudolaric acid B analog (Compound 13b) is semi-synthesized by efficient routines from Pseudolaric acid B. It has potent activities against HMEC-1, HL-60, A-549, MB-MDA-468, BEL-7402, HCT116, and Hela cells with IC50s ranging from 0.136 to 1.162 μM[1]. |
| Name | (1R,7S,8R,9R)-9-[(1E,3E)-4-Carboxy-1,3-pentadien-1-yl]-7-hydroxy-9-methyl-11-oxo-10-oxatricyclo[6.3.2.01,7]tridec-3-ene-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Demethoxydeacetoxypseudolaric acid B analog (Compound 13b) is semi-synthesized by efficient routines from Pseudolaric acid B. It has potent activities against HMEC-1, HL-60, A-549, MB-MDA-468, BEL-7402, HCT116, and Hela cells with IC50s ranging from 0.136 to 1.162 μM[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 665.9±55.0 °C at 760 mmHg |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 376.400 |
| Flash Point | 238.2±25.0 °C |
| Exact Mass | 376.152191 |
| LogP | 1.41 |
| Vapour Pressure | 0.0±4.6 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | QPFFEVMIQIJTGZ-PSAKCFHXSA-N |
| SMILES | CC(=CC=CC1(C)OC(=O)C23CC=C(C(=O)O)CCC2(O)C1CC3)C(=O)O |
| Hazard Codes | Xi |
|---|
| 1H-4,9a-Ethanocyclohepta[c]pyran-7-carboxylic acid, 3-[(1E,3E)-4-carboxy-1,3-pentadien-1-yl]-3,4,4a,5,6,9-hexahydro-4a-hydroxy-3-methyl-1-oxo-, (3R,4R,4aS,9aR)- |
| (1R,7S,8R,9R)-9-[(1E,3E)-4-Carboxy-1,3-pentadien-1-yl]-7-hydroxy-9-methyl-11-oxo-10-oxatricyclo[6.3.2.0]tridec-3-ene-4-carboxylic acid |