4-chloro-6-methyl-5-(3-phenylpropyl)pyrimidin-2-amine structure
|
Common Name | 4-chloro-6-methyl-5-(3-phenylpropyl)pyrimidin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 501657-66-5 | Molecular Weight | 261.75000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-6-methyl-5-(3-phenylpropyl)pyrimidin-2-amine |
|---|
| Molecular Formula | C14H16ClN3 |
|---|---|
| Molecular Weight | 261.75000 |
| Exact Mass | 261.10300 |
| PSA | 52.53000 |
| LogP | 3.12600 |
| InChIKey | KYVHJFUQVXEYQS-UHFFFAOYSA-N |
| SMILES | Cc1nc(N)nc(Cl)c1CCCc1ccccc1 |
|
~77%
4-chloro-6-meth... CAS#:501657-66-5 |
| Literature: Otzen, Thomas; Wempe, Ellen G.; Kunz, Brigitte; Bartels, Rainer; Lehwark-Yvetot, Gudrun; Haensel, Wolfram; Schaper, Klaus-Juergen; Seydel, Joachim K. Journal of Medicinal Chemistry, 2004 , vol. 47, # 1 p. 240 - 253 |
|
~%
4-chloro-6-meth... CAS#:501657-66-5 |
| Literature: Otzen, Thomas; Wempe, Ellen G.; Kunz, Brigitte; Bartels, Rainer; Lehwark-Yvetot, Gudrun; Haensel, Wolfram; Schaper, Klaus-Juergen; Seydel, Joachim K. Journal of Medicinal Chemistry, 2004 , vol. 47, # 1 p. 240 - 253 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |