benzyl 4-methyl-2-[(2-phenylmethoxycarbonylaminoacetyl)amino]pentanoate structure
|
Common Name | benzyl 4-methyl-2-[(2-phenylmethoxycarbonylaminoacetyl)amino]pentanoate | ||
|---|---|---|---|---|
| CAS Number | 50301-04-7 | Molecular Weight | 412.47900 | |
| Density | 1.165g/cm3 | Boiling Point | 600.7ºC at 760mmHg | |
| Molecular Formula | C23H28N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.1ºC | |
| Name | benzyl 4-methyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.165g/cm3 |
|---|---|
| Boiling Point | 600.7ºC at 760mmHg |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.47900 |
| Flash Point | 317.1ºC |
| Exact Mass | 412.20000 |
| PSA | 93.73000 |
| LogP | 3.96890 |
| InChIKey | SJZIFDKFUKLNIR-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)CNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
|
~%
benzyl 4-methyl... CAS#:50301-04-7 |
| Literature: Appel,R. et al. Chemische Berichte, 1975 , vol. 108, p. 2680 - 2692 |
|
~%
benzyl 4-methyl... CAS#:50301-04-7 |
| Literature: Crofts et al. Journal of the Chemical Society, 1959 , p. 3610,3613 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Z-Gly-Leu-OBzl |
| N-(N-Benzyloxycarbonyl-glycyl)-L-leucin-benzylester |
| N-(N-benzyloxycarbonyl-glycyl)-L-leucine benzyl ester |