1H-Indole,2,3-bis(4-methoxyphenyl)- structure
|
Common Name | 1H-Indole,2,3-bis(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5034-76-4 | Molecular Weight | 329.39200 | |
| Density | 1.174 g/cm3 | Boiling Point | 510.5ºC at 760mmHg | |
| Molecular Formula | C22H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.8ºC | |
| Name | 2,3-bis(4-methoxyphenyl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174 g/cm3 |
|---|---|
| Boiling Point | 510.5ºC at 760mmHg |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.39200 |
| Flash Point | 180.8ºC |
| Exact Mass | 329.14200 |
| PSA | 34.25000 |
| LogP | 5.51910 |
| Index of Refraction | 1.64 |
| InChIKey | SRETXDDCKMOQNE-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2[nH]c3ccccc3c2-c2ccc(OC)cc2)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Indoxol |
| Indossolo |
| 2,3-Bis-(p-methoxyphenyl)indol |
| Indoxolum |
| 2,3-Bis(p-methoxyphenyl)indole |
| 2,3-bis-(4-methoxy-phenyl)-1H-indole |
| INDOXOLE |
| 2,3-bis(4-methoxyphenyl)indole |