2,6-dichloro-4-(trifluoromethyl)nicotinic acid structure
|
Common Name | 2,6-dichloro-4-(trifluoromethyl)nicotinic acid | ||
|---|---|---|---|---|
| CAS Number | 503437-19-2 | Molecular Weight | 259.997 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 318.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H2Cl2F3NO2 | Melting Point | 79-80ºC | |
| MSDS | N/A | Flash Point | 146.2±27.9 °C | |
| Name | 2,6-dichloro-4-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 318.1±42.0 °C at 760 mmHg |
| Melting Point | 79-80ºC |
| Molecular Formula | C7H2Cl2F3NO2 |
| Molecular Weight | 259.997 |
| Flash Point | 146.2±27.9 °C |
| Exact Mass | 258.941467 |
| PSA | 50.19000 |
| LogP | 2.57 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | PZBCYMXYIZQNFE-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(C(F)(F)F)cc(Cl)nc1Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~86%
2,6-dichloro-4-... CAS#:503437-19-2 |
| Literature: Wang, Yamin; Bullock, William H.; Chen, Libing Patent: US6677352 B1, 2004 ; Location in patent: Page/Page column 48-49 ; |
|
~95%
2,6-dichloro-4-... CAS#:503437-19-2 |
| Literature: Wang, Yamin; Bullock, William H.; Chen, Libing Patent: US6677352 B1, 2004 ; Location in patent: Page/Page column 48 ; |
|
~%
2,6-dichloro-4-... CAS#:503437-19-2 |
| Literature: Tsuzuki, Yasunori; Tomita, Kyoji; Shibamori, Koh-Ichiro; Sato, Yuji; Kashimoto, Shigeki; Chiba, Katsumi Journal of Medicinal Chemistry, 2004 , vol. 47, # 8 p. 2097 - 2109 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5-dibromo-3,4,6-trifluorobenzene |
| 3-Pyridinecarboxylic acid, 2,6-dichloro-4-(trifluoromethyl)- |
| 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid |