2'-Methoxy-5'-(trifluoromethyl)acetophenone structure
|
Common Name | 2'-Methoxy-5'-(trifluoromethyl)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 503464-99-1 | Molecular Weight | 218.173 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 230.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H9F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 90.5±22.2 °C | |
| Name | 1-[2-methoxy-5-(trifluoromethyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 230.1±40.0 °C at 760 mmHg |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.173 |
| Flash Point | 90.5±22.2 °C |
| Exact Mass | 218.055466 |
| PSA | 26.30000 |
| LogP | 3.63 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.450 |
| InChIKey | FPJNPSGNLVIBBS-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(F)(F)F)cc1C(C)=O |
|
~67%
2'-Methoxy-5'-(... CAS#:503464-99-1 |
| Literature: WO2011/51478 A1, ; Page/Page column 56 ; WO 2011/051478 A1 |
|
~%
2'-Methoxy-5'-(... CAS#:503464-99-1 |
| Literature: US2003/109574 A1, ; |
|
~%
2'-Methoxy-5'-(... CAS#:503464-99-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 21, # 21 p. 6414 - 6416 |
| FXFFR CV1 DO1 |
| 2′-Methoxy-5′-(trifluoromethyl)acetophenone |
| Ethanone, 1-[2-methoxy-5-(trifluoromethyl)phenyl]- |
| 2'-Methoxy-5'-(trifluoromethyl)acetophenone |
| 1-[2-Methoxy-5-(trifluoromethyl)phenyl]ethanone |