2',5'-Bis(trifluoromethyl)acetophenone structure
|
Common Name | 2',5'-Bis(trifluoromethyl)acetophenone | ||
|---|---|---|---|---|
| CAS Number | 545410-47-7 | Molecular Weight | 256.145 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 206.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H6F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 76.9±21.5 °C | |
| Name | 1-[2,5-bis(trifluoromethyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 206.1±40.0 °C at 760 mmHg |
| Molecular Formula | C10H6F6O |
| Molecular Weight | 256.145 |
| Flash Point | 76.9±21.5 °C |
| Exact Mass | 256.032288 |
| PSA | 17.07000 |
| LogP | 4.16 |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
| Index of Refraction | 1.407 |
| InChIKey | ZBIHDCGAPRWDOA-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2914700090 |
|
~56%
2',5'-Bis(trifl... CAS#:545410-47-7 |
| Literature: Atwal, Karnail S.; Grover, Gary J.; Ding, Charles Z.; Stein, Philip D.; Lloyd, John; Ahmad, Saleem; Hamann, Lawrence G.; Green, David; Ferrara, Francis N. Patent: US2004/39033 A1, 2004 ; Location in patent: Page/Page column 17 ; US 20040039033 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Acetyl-1,4-bis(trifluoromethyl)benzene |
| 1-[2,5-Bis(trifluoromethyl)phenyl]ethanone |
| 2,5-bistrifluoromethyl-1-methylcarbonylbenzene |
| Ethanone, 1-[2,5-bis(trifluoromethyl)phenyl]- |
| 1-[2,5-Bis(trifluoromethyl)phenyl]ethan-1-one |
| 2',5'-Bis(trifluoromethyl)acetophenone |
| 1-[2,5-Bis(trifluoromethyl)phenyl]-1-ethanone |
| FXFFR BV1 DXFFF |