SAR502250 structure
|
Common Name | SAR502250 | ||
|---|---|---|---|---|
| CAS Number | 503860-57-9 | Molecular Weight | 367.37700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18FN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SAR502250SAR502250 is a potent, selective, ATP competitive, orally active and brain-penetrant inhibitor of GSK3, with an IC50 of 12 nM for human GSK-3β. SAR502250 displays antidepressant-like activity. SAR502250 can be used for the research of Alzheimer’s disease (AD). |
| Name | uda-680 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H18FN5O2 |
|---|---|
| Molecular Weight | 367.37700 |
| Exact Mass | 367.14400 |
| PSA | 73.14000 |
| LogP | 2.01930 |
| InChIKey | NKUNFNVAHJNALA-QGZVFWFLSA-N |
| SMILES | Cn1c(N2CCOC(c3ccc(F)cc3)C2)nc(-c2ccncn2)cc1=O |
| 2-[(2S)-2-(2-(4-fluorophenyl)morpholin-4-yl)]-1-methyl-1H-[4,4']bipyrimidinyl-6-one |