Isoliquiritoside structure
|
Common Name | Isoliquiritoside | ||
|---|---|---|---|---|
| CAS Number | 5041-81-6 | Molecular Weight | 418.394 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 743.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C21H22O9 | Melting Point | 185-186ºC | |
| MSDS | N/A | Flash Point | 263.3±26.4 °C | |
Use of IsoliquiritosideIsoliquiritin, isolated from Licorice Root, inhibits angiogenesis and tube formation. Isoliquiritin also exhibits antidepressant-like effects and antifungal activity[1][2][3]. |
| Name | isoliquiritin |
|---|---|
| Synonym | More Synonyms |
| Description | Isoliquiritin, isolated from Licorice Root, inhibits angiogenesis and tube formation. Isoliquiritin also exhibits antidepressant-like effects and antifungal activity[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 743.5±60.0 °C at 760 mmHg |
| Melting Point | 185-186ºC |
| Molecular Formula | C21H22O9 |
| Molecular Weight | 418.394 |
| Flash Point | 263.3±26.4 °C |
| Exact Mass | 418.126373 |
| PSA | 156.91000 |
| LogP | 0.76 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | YNWXJFQOCHMPCK-LXGDFETPSA-N |
| SMILES | O=C(C=Cc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1)c1ccc(O)cc1O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 2-Propen-1-one, 1-(2,4-dihydroxyphenyl)-3-[4-(β-D-glucopyranosyloxy)phenyl]-, (2E)- |
| Isoliquiritin |
| (E)-1-(2,4-dihydroxyphenyl)-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-en-1-one |
| 2-Propen-1-one, 1-(2,4-dihydroxyphenyl)-3-(4-(β-D-glucopyranosyloxy)phenyl)-, (2E)- |
| 4-[(1E)-3-(2,4-Dihydroxyphenyl)-3-oxo-1-propen-1-yl]phenyl β-D-glucopyranoside |