4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid structure
|
Common Name | 4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 50446-44-1 | Molecular Weight | 438.428 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 711.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C27H18O6 | Melting Point | 322-327ºC | |
| MSDS | Chinese USA | Flash Point | 397.7±29.4 °C | |
| Symbol |
GHS02, GHS07, GHS09 |
Signal Word | Danger | |
| Name | 1,3,5-Tri(4-carboxyphenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 711.0±60.0 °C at 760 mmHg |
| Melting Point | 322-327ºC |
| Molecular Formula | C27H18O6 |
| Molecular Weight | 438.428 |
| Flash Point | 397.7±29.4 °C |
| Exact Mass | 438.110352 |
| PSA | 111.90000 |
| LogP | 7.67 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | SATWKVZGMWCXOJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2cc(-c3ccc(C(=O)O)cc3)cc(-c3ccc(C(=O)O)cc3)c2)cc1 |
| Symbol |
GHS02, GHS07, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H228-H315-H319-H410 |
| Precautionary Statements | P210-P273-P305 + P351 + P338-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | F,Xn,N |
| Risk Phrases | 10-48/20-50/53-63-65-67 |
| Safety Phrases | 36/37-60-61-62 |
| RIDADR | UN 3175 4.1/PG 2 |
| HS Code | 2917399090 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
High-temperature in situ crystallographic observation of reversible gas sorption in impermeable organic cages.
Proc. Natl. Acad. Sci. U. S. A. 112 , 14156-61, (2015) Crystallographic observation of adsorbed gas molecules is a highly difficult task due to their rapid motion. Here, we report the in situ single-crystal and synchrotron powder X-ray observations of rev... |
| 1,3,5-Tris(4-carboxyphenyl)benzene |
| MFCD10000888 |
| 4-[3,5-bis(4-carboxyphenyl)phenyl]benzoic acid |