1,3,5-Tris(4'-bromophenyl)benzene structure
|
Common Name | 1,3,5-Tris(4'-bromophenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 7511-49-1 | Molecular Weight | 543.08800 | |
| Density | 1.626g/cm3 | Boiling Point | 574.9ºC at 760mmHg | |
| Molecular Formula | C24H15Br3 | Melting Point | 261-265ºC | |
| MSDS | Chinese USA | Flash Point | 289.1ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 1,3,5-Tris(4-bromophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.626g/cm3 |
|---|---|
| Boiling Point | 574.9ºC at 760mmHg |
| Melting Point | 261-265ºC |
| Molecular Formula | C24H15Br3 |
| Molecular Weight | 543.08800 |
| Flash Point | 289.1ºC |
| Exact Mass | 539.87200 |
| LogP | 8.97510 |
| Appearance of Characters | Crystalline Powder | Yellow to pale brown |
| Index of Refraction | 1.659 |
| InChIKey | HJQRITCAXSBOPC-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2cc(-c3ccc(Br)cc3)cc(-c3ccc(Br)cc3)c2)cc1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H318-H413 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R41 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2903999090 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,3,5-tris(4-bromophenyl)benzene |