4-Acetamido-1-benzylpiperidine structure
|
Common Name | 4-Acetamido-1-benzylpiperidine | ||
|---|---|---|---|---|
| CAS Number | 50534-23-1 | Molecular Weight | 232.32100 | |
| Density | 1.08g/cm3 | Boiling Point | 401.3ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O | Melting Point | 140ºC | |
| MSDS | N/A | Flash Point | 196.5ºC | |
| Name | 4-Acetamido-1-benzylpiperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 401.3ºC at 760 mmHg |
| Melting Point | 140ºC |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.32100 |
| Flash Point | 196.5ºC |
| Exact Mass | 232.15800 |
| PSA | 32.34000 |
| LogP | 2.11590 |
| Index of Refraction | 1.559 |
| InChIKey | PXKZVCOKJFOTQY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1CCN(Cc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
|
~96%
4-Acetamido-1-b... CAS#:50534-23-1 |
| Literature: ASTRAZENECA AB Patent: US2008/139612 A1, 2008 ; Location in patent: Page/Page column 10 ; US 20080139612 A1 |
|
~94%
4-Acetamido-1-b... CAS#:50534-23-1 |
| Literature: VIFOR (INTERNATIONAL) AG Patent: US2012/214798 A1, 2012 ; |
|
~%
4-Acetamido-1-b... CAS#:50534-23-1 |
| Literature: Pharmacia and Upjohn Company Patent: US5866589 A1, 1999 ; |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(1-benzylpiperidin-4-yl)acetamide |