2-Amino-6-nitrobenzoic acid structure
|
Common Name | 2-Amino-6-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 50573-74-5 | Molecular Weight | 182.133 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 412.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H6N2O4 | Melting Point | 189 °C (decomp) | |
| MSDS | USA | Flash Point | 203.1±25.9 °C | |
| Name | 2-Amino-6-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 412.3±35.0 °C at 760 mmHg |
| Melting Point | 189 °C (decomp) |
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.133 |
| Flash Point | 203.1±25.9 °C |
| Exact Mass | 182.032761 |
| PSA | 109.14000 |
| LogP | 1.58 |
| Appearance of Characters | Solid |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | GGKYLHNARFFORH-UHFFFAOYSA-N |
| SMILES | Nc1cccc([N+](=O)[O-])c1C(=O)O |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-Amino-6-nitrobenzoic acid |
| 2-amino-6-nitro-benzoic acid |
| 6-Nitro-anthranilsaeure |
| 2-Amino-6-nitro-benzoesaeure |
| Benzoic acid, 2-amino-6-nitro- |
| MFCD00034785 |
| 2-nitro-6-amino-benzoic acid |
| 6-Nitroanthranilic Acid |