2-acetamido-N,N-bis(2-chloropropyl)propanamide structure
|
Common Name | 2-acetamido-N,N-bis(2-chloropropyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 5064-14-2 | Molecular Weight | 283.19500 | |
| Density | 1.159g/cm3 | Boiling Point | 444.5ºC at 760 mmHg | |
| Molecular Formula | C11H20Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.6ºC | |
| Name | 2-acetamido-N,N-bis(2-chloropropyl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 444.5ºC at 760 mmHg |
| Molecular Formula | C11H20Cl2N2O2 |
| Molecular Weight | 283.19500 |
| Flash Point | 222.6ºC |
| Exact Mass | 282.09000 |
| PSA | 49.41000 |
| LogP | 1.98510 |
| Index of Refraction | 1.484 |
| InChIKey | HOSJGQGYOSAHID-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C)C(=O)N(CC(C)Cl)CC(C)Cl |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Acetamino-propionsaeure-<bis-(2-chlorpropyl)-amid> |
| n2-acetyl-n,n-bis(2-chloropropyl)alaninamide |