6-[(4-chlorophenyl)methylsulfanyl]-5H-purine structure
|
Common Name | 6-[(4-chlorophenyl)methylsulfanyl]-5H-purine | ||
|---|---|---|---|---|
| CAS Number | 5069-67-0 | Molecular Weight | 276.74500 | |
| Density | 1.51g/cm3 | Boiling Point | 426.8ºC at 760 mmHg | |
| Molecular Formula | C12H9ClN4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.9ºC | |
| Name | 6-[(4-chlorophenyl)methylsulfanyl]-7H-purine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 426.8ºC at 760 mmHg |
| Molecular Formula | C12H9ClN4S |
| Molecular Weight | 276.74500 |
| Flash Point | 211.9ºC |
| Exact Mass | 276.02400 |
| PSA | 79.76000 |
| LogP | 3.29860 |
| Index of Refraction | 1.753 |
| InChIKey | FOOOURJUHZNGIV-UHFFFAOYSA-N |
| SMILES | Clc1ccc(CSc2ncnc3nc[nH]c23)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-chlorobenzyl 7H-purin-6-yl sulfide |
| HMS2607M18 |
| 6-(4-chloro-benzylmercapto)-7(9)H-purine |
| 6-(4-Chlor-benzylmercapto)-7(9)H-purin |