6-[(4-methoxyphenyl)methylsulfanyl]-5H-purine structure
|
Common Name | 6-[(4-methoxyphenyl)methylsulfanyl]-5H-purine | ||
|---|---|---|---|---|
| CAS Number | 91803-44-0 | Molecular Weight | 272.32600 | |
| Density | 1.39g/cm3 | Boiling Point | 436.4ºC at 760 mmHg | |
| Molecular Formula | C13H12N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.7ºC | |
| Name | 6-[(4-methoxyphenyl)methylsulfanyl]-7H-purine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 436.4ºC at 760 mmHg |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.32600 |
| Flash Point | 217.7ºC |
| Exact Mass | 272.07300 |
| PSA | 88.99000 |
| LogP | 2.65380 |
| Index of Refraction | 1.706 |
| InChIKey | HRSGHLQOMVWURP-UHFFFAOYSA-N |
| SMILES | COc1ccc(CSc2ncnc3nc[nH]c23)cc1 |
|
~34%
6-[(4-methoxyph... CAS#:91803-44-0 |
| Literature: Pathak, Ashish K.; Pathak, Vibha; Seitz, Lainne E.; Suling, William J.; Reynolds, Robert C. Journal of Medicinal Chemistry, 2004 , vol. 47, # 1 p. 273 - 276 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| F3358-0085 |
| Purine,6-(p-methoxybenzylthio) |
| 6-(4-Methoxy-benzylmercapto)-purin |
| 6-[(4-methoxybenzyl)thio]purine |
| 6-(4-Methoxybenzylmercapto)purine |
| 6-(4-methoxy-benzylsulfanyl)-7(9)H-purine |