Bis(pentafluorophenyl)phenylphosphine structure
|
Common Name | Bis(pentafluorophenyl)phenylphosphine | ||
|---|---|---|---|---|
| CAS Number | 5074-71-5 | Molecular Weight | 442.19000 | |
| Density | N/A | Boiling Point | 105°C/0.3mm | |
| Molecular Formula | C18H5F10P | Melting Point | 55-60 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS08 |
Signal Word | Warning | |
| Name | Bis(pentafluorophenyl)phenylphosphine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 105°C/0.3mm |
|---|---|
| Melting Point | 55-60 °C(lit.) |
| Molecular Formula | C18H5F10P |
| Molecular Weight | 442.19000 |
| Flash Point | >230 °F |
| Exact Mass | 441.99700 |
| PSA | 13.59000 |
| LogP | 4.83580 |
| InChIKey | OYNXPGGNQMSMTR-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(P(c2ccccc2)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| Storage condition | 2-8°C |
| Symbol |
GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H351 |
| Supplemental HS | Repeated exposure may cause skin dryness or cracking. |
| Precautionary Statements | P281 |
| Target Organs | Blood, Central nervous system, Liver |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn,T,F |
| Risk Phrases | 36/37/38-20/21/22-40-63-43-23/24/25-45-67-66-36/38-11 |
| Safety Phrases | S26-S36/37/39-S22-S36/37-S24/25-S23-S53-S16-S9 |
| RIDADR | UN 1593 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 2903999090 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Ion abundance criteria for gas chromatographic/mass spectrometric environmental analysis.
J. Assoc. Off. Anal. Chem. 71(2) , 434-9, (1988) Mass and intensity calibration of gas chromatograph/mass spectrometer (GC/MS) responses is an important quality assurance issue for chemical analysis. Ion abundance calibration with decafluorotripheny... |
| EINECS 225-780-1 |
| MFCD00000291 |
| bis(2,3,4,5,6-pentafluorophenyl)-phenylphosphane |
| 2,3,4,5,6,2',3',4',5',6'-Decafluorotriphenylphosphine |
| DFTPP |