1,2-Bis(trimethylsilyloxy)benzene structure
|
Common Name | 1,2-Bis(trimethylsilyloxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 5075-52-5 | Molecular Weight | 254.47300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22O2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(2-trimethylsilyloxyphenoxy)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H22O2Si2 |
|---|---|
| Molecular Weight | 254.47300 |
| Exact Mass | 254.11600 |
| PSA | 18.46000 |
| LogP | 4.11400 |
| InChIKey | GEHYZCCVQVOFAF-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)Oc1ccccc1O[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1,2-bis-trimethylsilanyloxy-benzene |
| 1,2-Bis-trimethylsilyloxy-benzol |