2,6-Dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid hydrate structure
|
Common Name | 2,6-Dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid hydrate | ||
|---|---|---|---|---|
| CAS Number | 50887-69-9 | Molecular Weight | 174.111 | |
| Density | 1.642 g/cm3 | Boiling Point | 656.9ºCat 760 mmHg | |
| Molecular Formula | C5H6N2O5 | Melting Point | >300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 351.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Orotic Acid Monohydrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.642 g/cm3 |
|---|---|
| Boiling Point | 656.9ºCat 760 mmHg |
| Melting Point | >300 °C(lit.) |
| Molecular Formula | C5H6N2O5 |
| Molecular Weight | 174.111 |
| Flash Point | 351.1ºC |
| Exact Mass | 174.027664 |
| PSA | 112.25000 |
| InChIKey | YXUZGLGRBBHYFZ-UHFFFAOYSA-N |
| SMILES | O.O=C(O)c1cc(=O)[nH]c(=O)[nH]1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | RM3180000 |
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00149398 |
| 6-Carboxyuracil Monohydrate |
| 4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, monohydrate |
| 2,6-Dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid hydrate (1:1) |
| Orotic acid hydrate |
| Vitamin B13 monohydrate |
| Orotic acid monohydrate |
| 4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, hydrate (1:1) |
| 2,6-Dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid hydrate |
| EINECS 200-619-8 |
| 2,6-Dioxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid |
| Uracil-6-carboxylic acid monohydrate |