4-(Cyclohexylamino)-3-nitrobenzenemethanol
Modify Date: 2025-08-26 03:20:18
4-(Cyclohexylamino)-3-nitrobenzenemethanol structure
|
Common Name | 4-(Cyclohexylamino)-3-nitrobenzenemethanol | ||
|---|---|---|---|---|
| CAS Number | 509094-02-4 | Molecular Weight | 250.29400 | |
| Density | 1.27g/cm3 | Boiling Point | 452.7ºC at 760 mmHg | |
| Molecular Formula | C13H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.6ºC | |
| Name | [4-(cyclohexylamino)-3-nitrophenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 452.7ºC at 760 mmHg |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.29400 |
| Flash Point | 227.6ºC |
| Exact Mass | 250.13200 |
| PSA | 78.08000 |
| LogP | 3.42790 |
| Index of Refraction | 1.627 |
| InChIKey | DBXDPBYWCFZXOR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(CO)ccc1NC1CCCCC1 |
| HS Code | 2922199090 |
|---|
|
~%
4-(Cyclohexylam... CAS#:509094-02-4 |
| Literature: Tularik, Inc Patent: US2003/144286 A1, 2003 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:509094-03-5| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-cyclohexylamino-3-nitrobenzyl alcohol |
| I01-9395 |