4-Fluoro-3-nitrobenzyl alcohol structure
|
Common Name | 4-Fluoro-3-nitrobenzyl alcohol | ||
|---|---|---|---|---|
| CAS Number | 20274-69-5 | Molecular Weight | 171.126 | |
| Density | 1.434 | Boiling Point | 333.7±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H6FNO3 | Melting Point | 39-44ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 155.6±23.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (4-fluoro-3-nitrophenyl)methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.434 |
|---|---|
| Boiling Point | 333.7±27.0 °C at 760 mmHg |
| Melting Point | 39-44ºC(lit.) |
| Molecular Formula | C7H6FNO3 |
| Molecular Weight | 171.126 |
| Flash Point | 155.6±23.7 °C |
| Exact Mass | 171.033173 |
| PSA | 66.05000 |
| LogP | 0.51 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | MKWJZTFMDWSRIH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(CO)ccc1F |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Experimentally induced phenylketonuria. II. Potential inhibitors of phenylalanine hydroxylase.
J. Med. Chem. 11(2) , 225-7, (1968)
|
| 4-Fluoro-3-nitrobenzylalcohol |
| (4-Fluoro-3-nitrophenyl)methanol |
| Benzenemethanol, 4-fluoro-3-nitro- |
| 4-fluoro-3-nitrobenzenemethanol |
| (4-fluoro-3-nitro-phenyl)methanol |
| (4-fluoro-3-nitro-phenyl)-rnethanol |
| MFCD01861396 |
| 4-Fluoro-3-nitrobenzyl alcohol |