6-(4-chlorophenyl)sulfonylquinazoline-2,4-diamine structure
|
Common Name | 6-(4-chlorophenyl)sulfonylquinazoline-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 51123-82-1 | Molecular Weight | 334.78100 | |
| Density | 1.558g/cm3 | Boiling Point | 672.4ºC at 760mmHg | |
| Molecular Formula | C14H11ClN4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 360.4ºC | |
| Name | 6-(4-chlorophenyl)sulfonylquinazoline-2,4-diamine |
|---|
| Density | 1.558g/cm3 |
|---|---|
| Boiling Point | 672.4ºC at 760mmHg |
| Molecular Formula | C14H11ClN4O2S |
| Molecular Weight | 334.78100 |
| Flash Point | 360.4ºC |
| Exact Mass | 334.02900 |
| PSA | 120.34000 |
| LogP | 4.52360 |
| Index of Refraction | 1.727 |
| InChIKey | BEOVNLZTAZDKBA-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c2cc(S(=O)(=O)c3ccc(Cl)cc3)ccc2n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |