trimethyl ethylenetricarboxylate
trimethyl ethylenetricarboxylate structure
|
Common Name | trimethyl ethylenetricarboxylate | ||
|---|---|---|---|---|
| CAS Number | 51175-48-5 | Molecular Weight | 202.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trimethyl ethylenetricarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H10O6 |
|---|---|
| Molecular Weight | 202.16100 |
| Exact Mass | 202.04800 |
| PSA | 78.90000 |
| InChIKey | QKUGMJHHSODNHU-UHFFFAOYSA-N |
| SMILES | COC(=O)C=C(C(=O)OC)C(=O)OC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 6 | |
CAS#:52003-37-9
CAS#:40967-67-7
CAS#:22650-26-6
CAS#:69327-00-0
CAS#:922-84-9
CAS#:61707-70-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Aethentricarbonsaeure-trimethylester |
| ethene-1,1,2-tricarboxylic acid trimethyl ester |
| ethenetricarboxylic acid trimethyl ester |
| methyl 1,3-dimethoxycarbonylacrylate |
| trimethyl ethene-tricarboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of trimethyl ethylenetricarboxylate? |
| A: InChIKey of trimethyl ethylenetricarboxylate is QKUGMJHHSODNHU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of trimethyl ethylenetricarboxylate? |
| A: Molecular weight of trimethyl ethylenetricarboxylate is 202.16100. |
| Q: What is the polar surface area (PSA) of trimethyl ethylenetricarboxylate? |
| A: Polar surface area (PSA) of trimethyl ethylenetricarboxylate is 78.90000. |
| Q: What is the English name of trimethyl ethylenetricarboxylate? |
| A: The English name of trimethyl ethylenetricarboxylate is trimethyl ethylenetricarboxylate. |
| Q: What English synonyms does trimethyl ethylenetricarboxylate have? |
| A: English synonyms of trimethyl ethylenetricarboxylate: Aethentricarbonsaeure-trimethylester, ethene-1,1,2-tricarboxylic acid trimethyl ester, ethenetricarboxylic acid trimethyl ester, methyl 1,3-dimethoxycarbonylacrylate, trimethyl ethene-tricarboxylate. |
| Q: What is the CAS number of trimethyl ethylenetricarboxylate? |
| A: CAS number of trimethyl ethylenetricarboxylate is 51175-48-5. |
| Q: What is the SMILES notation of trimethyl ethylenetricarboxylate? |
| A: SMILES notation of trimethyl ethylenetricarboxylate is COC(=O)C=C(C(=O)OC)C(=O)OC. |
| Q: What is the molecular formula of trimethyl ethylenetricarboxylate? |
| A: Molecular formula of trimethyl ethylenetricarboxylate is C8H10O6. |
| Q: What is the Chinese name of 51175-48-5? |
| A: Chinese name of 51175-48-5 is 51175-48-5. |
| Q: What are the downstream products of trimethyl ethylenetricarboxylate? |
| A: Related downstream products(CAS) of trimethyl ethylenetricarboxylate: 52003-37-9;40967-67-7;22650-26-6;69327-00-0;922-84-9;61707-70-8. |