diethyl 2-phenylpropanedioate
Modify Date: 2025-08-22 18:22:50
diethyl 2-phenylpropanedioate structure
|
Common Name | diethyl 2-phenylpropanedioate | ||
|---|---|---|---|---|
| CAS Number | 5122-44-1 | Molecular Weight | 366.48000 | |
| Density | 1.111g/cm3 | Boiling Point | 301ºC at 760mmHg | |
| Molecular Formula | C20H22N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2,4-dimethylphenyl)-2-[[4-methyl-5-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|
| Density | 1.111g/cm3 |
|---|---|
| Boiling Point | 301ºC at 760mmHg |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.48000 |
| Exact Mass | 366.15100 |
| PSA | 88.60000 |
| LogP | 4.78760 |
| Index of Refraction | 1.634 |
| InChIKey | ATOFUFUOTROATQ-UHFFFAOYSA-N |
| SMILES | CC(C)=CCN=c1ncn(CC=C(C)C)c2nc[nH]c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |