Methylene-bis(4-cyclohexylisocyanate) structure
|
Common Name | Methylene-bis(4-cyclohexylisocyanate) | ||
|---|---|---|---|---|
| CAS Number | 5124-30-1 | Molecular Weight | 262.34700 | |
| Density | 1.066 g/mL at 25 °C(lit.) | Boiling Point | 168 °C / 1.5mmHg | |
| Molecular Formula | C15H22N2O2 | Melting Point | 25°C | |
| MSDS | Chinese USA | Flash Point | 211 ºC | |
| Symbol |
GHS06, GHS08 |
Signal Word | Danger | |
| Name | dicyclohexylmethane-4,4'-diisocyanate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.066 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 168 °C / 1.5mmHg |
| Melting Point | 25°C |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.34700 |
| Flash Point | 211 ºC |
| Exact Mass | 262.16800 |
| PSA | 58.86000 |
| LogP | 3.16570 |
| Index of Refraction | n20/D 1.497(lit.) |
| InChIKey | KORSJDCBLAPZEQ-UHFFFAOYSA-N |
| SMILES | O=C=NC1CCC(CC2CCC(N=C=O)CC2)CC1 |
| Water Solubility | Insoluble/Reactive |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H317-H319-H331-H334-H335 |
| Precautionary Statements | P261-P280-P284-P304 + P340 + P312-P342 + P311-P403 + P233 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T:Toxic; |
| Risk Phrases | R23;R36/37/38;R42/43 |
| Safety Phrases | S26-S28-S38-S45-S1/2 |
| RIDADR | UN 2206 6.1/PG 2 |
| WGK Germany | 1 |
| RTECS | NQ9250000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
|
Multiple shape memory polymers based on laminates formed from thiol-click chemistry based polymerizations.
Soft Matter 11 , 6852-8, (2015) This investigation details the formation of polymer network trilayer laminates formed by thiol-X click chemistries, and their subsequent implementation and evaluation for quadruple shape memory behavi... |
|
|
Functionalization of graphene oxide nanostructures improves photoluminescence and facilitates their use as optical probes in preclinical imaging.
Nanoscale 7 , 10410-20, (2015) Recently reported photoluminescent nanographene oxides (nGOs), i.e. nanographene oxidised with a sulfuric/nitric acid mixture (SNOx method), have tuneable photoluminescence and are scalable, simple an... |
|
|
Fabrication of chiral amino acid ionic liquid modified magnetic multifunctional nanospheres for centrifugal chiral chromatography separation of racemates.
J. Chromatogr. A. 1400 , 40-6, (2015) As the rapid development of nanotechnology, the magnetic nanospheres modified with special chiral selective ligands show a great potentiality in enantiomeric separation. In this study, magnetic nanosp... |
| Methylene-bis(4-cyclohexylisocyanate) |
| 4,4'-Methylenebis(cyclohexyl isocyanate) |
| Dicyclohexylmethane 4,4′-diisocyanate |
| MFCD00015405 |
| Dicyclohexylmethane 4,4'-Diisocyanate |
| 4,4-Methylenebis(Cyclohexyl Isocyanate) |
| EINECS 225-863-2 |