N-(4-acetylphenyl)-3-chloro-propionamide
Modify Date: 2025-11-28 20:19:36
N-(4-acetylphenyl)-3-chloro-propionamide structure
|
Common Name | N-(4-acetylphenyl)-3-chloro-propionamide | ||
|---|---|---|---|---|
| CAS Number | 51256-02-1 | Molecular Weight | 225.67100 | |
| Density | 1.24g/cm3 | Boiling Point | 438.5ºC at 760 mmHg | |
| Molecular Formula | C11H12ClNO2 | Melting Point | 152-155ºC | |
| MSDS | N/A | Flash Point | 219ºC | |
| Name | n-(4-acetylphenyl)-3-chloropropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 438.5ºC at 760 mmHg |
| Melting Point | 152-155ºC |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67100 |
| Flash Point | 219ºC |
| Exact Mass | 225.05600 |
| PSA | 46.17000 |
| LogP | 2.52960 |
| Index of Refraction | 1.573 |
| InChIKey | CFTHHVYPCUMUNT-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(NC(=O)CCCl)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~%
N-(4-acetylphen... CAS#:51256-02-1 |
| Literature: Profft; Jumar Archiv der Pharmazie (Weinheim, Germany), 1956 , vol. 289, p. 90,97 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:90279-42-8| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-acetyl-3-chloropropionanilide |
| 3-Chlor-propionsaeure-(4-acetyl-anilid) |
| 3-chloro-propionic acid-(4-acetyl-anilide) |