N-(1,1'-Biphenyl)-4-yl-2-hydroxyacetamide structure
|
Common Name | N-(1,1'-Biphenyl)-4-yl-2-hydroxyacetamide | ||
|---|---|---|---|---|
| CAS Number | 51410-51-6 | Molecular Weight | 227.25900 | |
| Density | 1.226g/cm3 | Boiling Point | 472.8ºC at 760mmHg | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.7ºC | |
| Name | 2-hydroxy-N-(4-phenylphenyl)acetamide |
|---|
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 472.8ºC at 760mmHg |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Flash Point | 239.7ºC |
| Exact Mass | 227.09500 |
| PSA | 49.33000 |
| LogP | 2.35740 |
| Index of Refraction | 1.638 |
| InChIKey | PNSQNTUPOMQLLC-UHFFFAOYSA-N |
| SMILES | O=C(CO)Nc1ccc(-c2ccccc2)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |