[1,1'-Biphenyl]-4-aceticacid, a-hydroxy structure
|
Common Name | [1,1'-Biphenyl]-4-aceticacid, a-hydroxy | ||
|---|---|---|---|---|
| CAS Number | 450-52-2 | Molecular Weight | 228.24300 | |
| Density | 1.265g/cm3 | Boiling Point | 440.5ºC at 760 mmHg | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.3ºC | |
| Name | 2-hydroxy-2-(4-phenylphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 440.5ºC at 760 mmHg |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.24300 |
| Flash Point | 234.3ºC |
| Exact Mass | 228.07900 |
| PSA | 57.53000 |
| LogP | 2.47160 |
| Vapour Pressure | 1.55E-08mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | JLZDBGVLWCMKMH-UHFFFAOYSA-N |
| SMILES | O=C(O)C(O)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2918199090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: Inhibition of glycolic acid oxidase (unknown origin) assessed as enzyme-mediated redu...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3252910
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 4-phenylmandelic acid |
| Phenylmandelic acid |
| p-Phenylmandelic acid |
| Phenol-mandelic acid |
| 4-Phenyl-mandelsaeure |