(3-methacrylamidopropyl)trimethylammonium chloride structure
|
Common Name | (3-methacrylamidopropyl)trimethylammonium chloride | ||
|---|---|---|---|---|
| CAS Number | 51410-72-1 | Molecular Weight | 220.74000 | |
| Density | 1.053 g/mL at 25ºC | Boiling Point | 100ºC | |
| Molecular Formula | C10H21ClN2O | Melting Point | -22.5ºC | |
| MSDS | Chinese | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [3-(Methacryloylamino)propyl]trimethylammonium chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.053 g/mL at 25ºC |
|---|---|
| Boiling Point | 100ºC |
| Melting Point | -22.5ºC |
| Molecular Formula | C10H21ClN2O |
| Molecular Weight | 220.74000 |
| Exact Mass | 220.13400 |
| PSA | 29.10000 |
| Index of Refraction | n20/D 1.43 |
| InChIKey | UZNHKBFIBYXPDV-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)C.[Cl-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924199090 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00011812 |
| Acrylamido buffer |
| EINECS 257-182-1 |
| 3-Methacrylamido-N,N,N-trimethylpropan-1-aminium chloride |
| METHACRYLAMIDOPROPYLTRIMETHYLAMMONIUM CHLORIDE |