alpha-Bisabolol structure
|
Common Name | alpha-Bisabolol | ||
|---|---|---|---|---|
| CAS Number | 515-69-5 | Molecular Weight | 222.366 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 314.5±11.0 °C at 760 mmHg | |
| Molecular Formula | C15H26O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.2±15.6 °C | |
Use of alpha-Bisabololalpha-Bisabolol is a nontoxic sesquiterpene alcohol present in natural essential oil, with anticancer activity. alpha-Bisabolol exerts selective anticancer effect on A549 NSCLC cells (IC50=15 μM) via induction of cell cycle arrest, mitochondrial apoptosis and inhibition of PI3K/Akt signalling pathways. alpha-Bisabolol also strongly induces apoptosis in glioma cells[1][2]. |
| Name | alpha-Bisabolol |
|---|---|
| Synonym | More Synonyms |
| Description | alpha-Bisabolol is a nontoxic sesquiterpene alcohol present in natural essential oil, with anticancer activity. alpha-Bisabolol exerts selective anticancer effect on A549 NSCLC cells (IC50=15 μM) via induction of cell cycle arrest, mitochondrial apoptosis and inhibition of PI3K/Akt signalling pathways. alpha-Bisabolol also strongly induces apoptosis in glioma cells[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 314.5±11.0 °C at 760 mmHg |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.366 |
| Flash Point | 113.2±15.6 °C |
| Exact Mass | 222.198364 |
| PSA | 20.23000 |
| LogP | 5.07 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | RGZSQWQPBWRIAQ-LOACHALJSA-N |
| SMILES | CC(C)=CCCC(C)(O)C1CC=C(C)CC1 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Risk Phrases | R33 |
|---|---|
| RIDADR | 3439.0 |
| WGK Germany | 2 |
| RTECS | MJ9685000 |
| Hazard Class | 6.1 |
| HS Code | 29061900 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 29061900 |
|---|
| MFCD03846910 |
| rel-(2R)-6-Methyl-2-[(1R)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-ol |
| )-α-Bisabolol |
| a-Bisabolol |
| α-Bisabolol |
| dl-a-Bisabolol |
| (+/-)-α-Bisabolol |
| (2R)-6-Methyl-2-[(1R)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-ol |
| 6-Methyl-2-(4-methyl-3-cyclohexen-1-yl)-5-hepten-2-ol |
| EINECS 208-205-9 |
| (2R)-6-Methyl-2-[(1R)-4-methyl-3-cyclohexen-1-yl]-5-hepten-2-ol |
| Dragosantol |
| (R*,R*)-6-Dethyl-2-(4-methyl-3-cyclohexen-1-yl)-5-Hepten-2-ol |
| (±)-a-Bisabolol |