5-AMINO-1-(3-CHLOROPHENYL)-1H-PYRAZOLE-4-CARBONITRILE structure
|
Common Name | 5-AMINO-1-(3-CHLOROPHENYL)-1H-PYRAZOLE-4-CARBONITRILE | ||
|---|---|---|---|---|
| CAS Number | 51516-68-8 | Molecular Weight | 218.64200 | |
| Density | 1.411g/cm3 | Boiling Point | 433.947ºC at 760 mmHg | |
| Molecular Formula | C10H7ClN4 | Melting Point | 183-187ºC | |
| MSDS | Chinese USA | Flash Point | 216.244ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 5-amino-1-(3-chlorophenyl)pyrazole-4-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.411g/cm3 |
|---|---|
| Boiling Point | 433.947ºC at 760 mmHg |
| Melting Point | 183-187ºC |
| Molecular Formula | C10H7ClN4 |
| Molecular Weight | 218.64200 |
| Flash Point | 216.244ºC |
| Exact Mass | 218.03600 |
| PSA | 67.63000 |
| LogP | 2.56078 |
| Index of Refraction | 1.686 |
| InChIKey | VRKRSWGTAMOYEV-UHFFFAOYSA-N |
| SMILES | N#Cc1cnn(-c2cccc(Cl)c2)c1N |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 22-37/38-41 |
| Safety Phrases | 26-36/39 |
| RIDADR | NONH for all modes of transport |
| Packaging Group | III |
| HS Code | 2933199090 |
|
~69%
5-AMINO-1-(3-CH... CAS#:51516-68-8 |
| Literature: DeveloGen Aktiengesellschaft; Evotec AG Patent: EP1746099 A1, 2007 ; Location in patent: Page/Page column 14 ; |
|
~69%
5-AMINO-1-(3-CH... CAS#:51516-68-8 |
| Literature: Harden; Quinn; Scammells Journal of Medicinal Chemistry, 1991 , vol. 34, # 9 p. 2892 - 2898 |
|
~%
5-AMINO-1-(3-CH... CAS#:51516-68-8 |
| Literature: Harden; Quinn; Scammells Journal of Medicinal Chemistry, 1991 , vol. 34, # 9 p. 2892 - 2898 |
|
~%
5-AMINO-1-(3-CH... CAS#:51516-68-8 |
| Literature: Harden; Quinn; Scammells Journal of Medicinal Chemistry, 1991 , vol. 34, # 9 p. 2892 - 2898 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Amino-1-(m-chlorophenyl)-4-cyanopyrazol |
| 5-amino-1-(3-chlorophenyl)-1H-pyrazole-4-carbonitrile |
| F2135-0880 |
| MFCD00128298 |