1,3,4,6-Tetrachloro-3a,6a-diphenylglycouril structure
|
Common Name | 1,3,4,6-Tetrachloro-3a,6a-diphenylglycouril | ||
|---|---|---|---|---|
| CAS Number | 51592-06-4 | Molecular Weight | 432.08800 | |
| Density | 1.76 g/cm3 | Boiling Point | 510ºC at 760 mmHg | |
| Molecular Formula | C16H10Cl4N4O2 | Melting Point | 249-252 °C (lit.) | |
| MSDS | Chinese USA | Flash Point | 262.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,3,4,6-tetrachloro-3a,6a-diphenylimidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.76 g/cm3 |
|---|---|
| Boiling Point | 510ºC at 760 mmHg |
| Melting Point | 249-252 °C (lit.) |
| Molecular Formula | C16H10Cl4N4O2 |
| Molecular Weight | 432.08800 |
| Flash Point | 262.2ºC |
| Exact Mass | 429.95600 |
| PSA | 47.10000 |
| LogP | 4.53440 |
| Index of Refraction | 1.764 |
| InChIKey | FJQZXCPWAGYPSD-UHFFFAOYSA-N |
| SMILES | O=C1N(Cl)C2(c3ccccc3)N(Cl)C(=O)N(Cl)C2(c2ccccc2)N1Cl |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~96%
1,3,4,6-Tetrach... CAS#:51592-06-4 |
| Literature: Shiri, Azam; Khoramabadi-Zad, Ahmad Synthesis, 2009 , # 16 p. 2797 - 2801 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
|
Comparison of two methods for radioiodination on the oxidizability properties of low density lipoprotein.
J. Physiol. Biochem. 57(4) , 291-301, (2001) Radiolabeling of low density lipoprotein (LDL) apoB100 with 125I, an oxidative process, is commonly used in lipoprotein investigation. Since 1) LDL is unstable and oxidation-prone, 2) the modification... |
|
|
Biodistribution and radiation dosimetry of radioiodinated hypericin as a cancer therapeutic.
Int. J. Oncol. 44(3) , 819-29, (2014) Iodine-131‑labeled monoiodohypericin (131I‑Hyp) is a necrosis avid compound used as a complementary anticancer agent. Herein, the biodistribution in rats with re-perfused partial liver infarction (RPL... |
|
|
Comparative methods for the radiolabeling of peptides.
Meth. Enzymol. 124 , 18-29, (1986)
|
| 1,3,4,6-Tetrachloro-3a,6a-diphenylglycoluril |
| GLYCOLURIL,1,3,4,6-TETRACHLORO-3a,6a-DIPHENYL |
| Tetrachlorodiphenylglycoluril |
| 1,3,4,6-Tetrachloro-3alpha,6alpha-diphenylglycouril |
| Iodo-gen |
| Imidazo(4,5-d)imidazole-2,5(1H,3H)-dione,1,3,4,6-tetrachlorotetrahydro-3a,6a-diphenyl |
| 1,3,4,6-Tetrachlorotetrahydro-3a,6a-diphenylimidazo(4,5-d)imidazole-2,5(1H,3H)-dione |
| MFCD00027367 |