3-(2-Oxo-1,2-dihydro-4-quinolinyl)alanine structure
|
Common Name | 3-(2-Oxo-1,2-dihydro-4-quinolinyl)alanine | ||
|---|---|---|---|---|
| CAS Number | 5162-90-3 | Molecular Weight | 232.235 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 522.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H12N2O3 | Melting Point | 265-266ºC | |
| MSDS | N/A | Flash Point | 269.9±30.1 °C | |
| Name | 2-Amino-3-(1,2-Dihydro-2-Oxoquinoline-4-yl)Propanoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 522.7±50.0 °C at 760 mmHg |
| Melting Point | 265-266ºC |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.235 |
| Flash Point | 269.9±30.1 °C |
| Exact Mass | 232.084793 |
| PSA | 96.18000 |
| LogP | 0.80 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | NOILRCJONSGSRP-UHFFFAOYSA-N |
| SMILES | NC(Cc1cc(=O)[nH]c2ccccc12)C(=O)O |
|
~95%
3-(2-Oxo-1,2-di... CAS#:5162-90-3 |
| Literature: OTSUKA PHARMACEUTICAL CO., LTD. Patent: WO2006/117977 A1, 2006 ; Location in patent: Page/Page column 11-12 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Amino-3-(1,2-dihydro-2-oxoquinoline-4-yl)propanoic acid |
| 3-(2-Oxo-1,2-dihydro-4-quinolinyl)alanine |
| 3-(2-Oxo-1,2-dihydroquinolin-4-yl)alanine |
| MFCD07787426 |
| 2-Amino-3-(2-oxo-1,2-dihydroquinolin-4-yl)propanoic acid |
| 4-Quinolinepropanoic acid, α-amino-1,2-dihydro-2-oxo- |