bis[2-oxo-2-(4-phenylphenyl)ethyl] hexanedioate
Modify Date: 2025-09-26 19:18:52
![bis[2-oxo-2-(4-phenylphenyl)ethyl] hexanedioate Structure](https://image.chemsrc.com/caspic/348/5166-56-3.png)
bis[2-oxo-2-(4-phenylphenyl)ethyl] hexanedioate structure
|
Common Name | bis[2-oxo-2-(4-phenylphenyl)ethyl] hexanedioate | ||
|---|---|---|---|---|
| CAS Number | 5166-56-3 | Molecular Weight | 534.59800 | |
| Density | 1.188g/cm3 | Boiling Point | 698ºC at 760 mmHg | |
| Molecular Formula | C34H30O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.7ºC | |
| Name | bis[2-oxo-2-(4-phenylphenyl)ethyl] hexanedioate |
|---|
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 698ºC at 760 mmHg |
| Molecular Formula | C34H30O6 |
| Molecular Weight | 534.59800 |
| Flash Point | 291.7ºC |
| Exact Mass | 534.20400 |
| PSA | 86.74000 |
| LogP | 6.73300 |
| Index of Refraction | 1.586 |
| InChIKey | WUDLOOOZGZINTP-UHFFFAOYSA-N |
| SMILES | O=C(CCCCC(=O)OCC(=O)c1ccc(-c2ccccc2)cc1)OCC(=O)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2918300090 |
|---|
|
~%
bis[2-oxo-2-(4-... CAS#:5166-56-3 |
| Literature: Drake; Sweeney Journal of the American Chemical Society, 1932 , vol. 54, p. 2059 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |