bis[2-oxo-2-(4-phenylphenyl)ethyl] oxalate structure
|
Common Name | bis[2-oxo-2-(4-phenylphenyl)ethyl] oxalate | ||
|---|---|---|---|---|
| CAS Number | 7497-82-7 | Molecular Weight | 478.49200 | |
| Density | 1.246g/cm3 | Boiling Point | 658.4ºC at 760 mmHg | |
| Molecular Formula | C30H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.3ºC | |
| Name | bis[2-oxo-2-(4-phenylphenyl)ethyl] oxalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 658.4ºC at 760 mmHg |
| Molecular Formula | C30H22O6 |
| Molecular Weight | 478.49200 |
| Flash Point | 280.3ºC |
| Exact Mass | 478.14200 |
| PSA | 86.74000 |
| LogP | 5.17260 |
| Index of Refraction | 1.606 |
| InChIKey | NOHZLJFSIMBBHQ-UHFFFAOYSA-N |
| SMILES | O=C(OCC(=O)c1ccc(-c2ccccc2)cc1)C(=O)OCC(=O)c1ccc(-c2ccccc2)cc1 |
|
~%
bis[2-oxo-2-(4-... CAS#:7497-82-7 |
| Literature: Drake; Bronitsky Journal of the American Chemical Society, 1930 , vol. 52, p. 3715,3716, 3719 |
|
~%
bis[2-oxo-2-(4-... CAS#:7497-82-7 |
| Literature: Drake; Bronitsky Journal of the American Chemical Society, 1930 , vol. 52, p. 3715,3716, 3719 |
|
~%
bis[2-oxo-2-(4-... CAS#:7497-82-7 |
| Literature: Drake; Bronitsky Journal of the American Chemical Society, 1930 , vol. 52, p. 3715,3716, 3719 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Oxalsaeure-bis-(4-phenyl-phenacylester) |
| oxalic acid bis-(4-phenyl-phenacyl ester) |
| p-Phenylphenacyloxalat |
| Oxalsaeure-di-<4-phenyl-phenacyl-ester> |