Isopteropodine
Modify Date: 2025-08-20 20:23:32
Isopteropodine structure
|
Common Name | Isopteropodine | ||
|---|---|---|---|---|
| CAS Number | 5171-37-9 | Molecular Weight | 368.42600 | |
| Density | 1.33g/cm3 | Boiling Point | 555.2ºC at 760 mmHg | |
| Molecular Formula | C21H24N2O4 | Melting Point | 209-211 °C | |
| MSDS | N/A | Flash Point | 289.6ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
Use of IsopteropodineIsopteropodine is heteroyohimbine-type oxindole alkaloid components of Uncaria tomentosa (Willd.) DC. Isopteropodine acts as positive modulators of muscarinic M1 and 5-HT2 receptors[1]. |
| Name | uncarine e |
|---|---|
| Synonym | More Synonyms |
| Description | Isopteropodine is heteroyohimbine-type oxindole alkaloid components of Uncaria tomentosa (Willd.) DC. Isopteropodine acts as positive modulators of muscarinic M1 and 5-HT2 receptors[1]. |
|---|---|
| Related Catalog | |
| Target |
5-HT2 Receptor |
| References |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 555.2ºC at 760 mmHg |
| Melting Point | 209-211 °C |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.42600 |
| Flash Point | 289.6ºC |
| Exact Mass | 368.17400 |
| PSA | 67.87000 |
| LogP | 2.13840 |
| Index of Refraction | 1.635 |
| InChIKey | JMIAZDVHNCCPDM-PFDNRQJHSA-N |
| SMILES | COC(=O)C1=COC(C)C2CN3CCC4(C(=O)Nc5ccccc54)C3CC12 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300 |
| Precautionary Statements | Missing Phrase - N15.00950417 |
| RIDADR | NONH for all modes of transport |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:4697-68-1| Isopteropodine |