2-acetoxy-5-nitrobenzyl chloride structure
|
Common Name | 2-acetoxy-5-nitrobenzyl chloride | ||
|---|---|---|---|---|
| CAS Number | 5174-32-3 | Molecular Weight | 229.61700 | |
| Density | 1.378g/cm3 | Boiling Point | 382.2ºC at 760 mmHg | |
| Molecular Formula | C9H8ClNO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 184.9ºC | |
| Name | [2-(chloromethyl)-4-nitrophenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.378g/cm3 |
|---|---|
| Boiling Point | 382.2ºC at 760 mmHg |
| Molecular Formula | C9H8ClNO4 |
| Molecular Weight | 229.61700 |
| Flash Point | 184.9ºC |
| Exact Mass | 229.01400 |
| PSA | 72.12000 |
| LogP | 2.78210 |
| Index of Refraction | 1.56 |
| InChIKey | XLEUIPVVUKAVGL-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc([N+](=O)[O-])cc1CCl |
|
~%
2-acetoxy-5-nit... CAS#:5174-32-3 |
| Literature: Jacobs; Heidelberger Journal of Biological Chemistry, 1915 , vol. 20, p. 674 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| bia1040 |
| 2-acetoxy-5-nitrobenzyl chloride |