3-[tris(acetoxy)silyl]propyl methacrylate structure
|
Common Name | 3-[tris(acetoxy)silyl]propyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 51772-85-1 | Molecular Weight | 332.37900 | |
| Density | 1.155g/cm3 | Boiling Point | 356ºC at 760 mmHg | |
| Molecular Formula | C13H20O8Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.5ºC | |
| Name | 3-triacetyloxysilylpropyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.155g/cm3 |
|---|---|
| Boiling Point | 356ºC at 760 mmHg |
| Molecular Formula | C13H20O8Si |
| Molecular Weight | 332.37900 |
| Flash Point | 140.5ºC |
| Exact Mass | 332.09300 |
| PSA | 105.20000 |
| LogP | 1.12400 |
| Index of Refraction | 1.452 |
| InChIKey | MLOKHANBEXWBKS-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCC[Si](OC(C)=O)(OC(C)=O)OC(C)=O |
| HS Code | 2931900090 |
|---|
|
~82%
3-[tris(acetoxy... CAS#:51772-85-1 |
| Literature: Efimov, Yu. T.; Tandura, T. A.; Kopylov, V. M.; Androsenko, S. I.; Shkol'nik, M. I. J. Gen. Chem. USSR (Engl. Transl.), 1991 , vol. 61, # 10 p. 2244 - 2253,2083 - 2091 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| EINECS 257-407-3 |
| 3-(Tris(acetoxy)silyl)propyl methacrylate |
| 3-(triacetoxysilyl)propyl methacrylate |