1,8-Naphthalenedicarboxylicacid structure
|
Common Name | 1,8-Naphthalenedicarboxylicacid | ||
|---|---|---|---|---|
| CAS Number | 518-05-8 | Molecular Weight | 216.19000 | |
| Density | 1.454g/cm3 | Boiling Point | 511.6ºC at 760mmHg | |
| Molecular Formula | C12H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.3ºC | |
| Name | naphthalene-1,8-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.454g/cm3 |
|---|---|
| Boiling Point | 511.6ºC at 760mmHg |
| Molecular Formula | C12H8O4 |
| Molecular Weight | 216.19000 |
| Flash Point | 277.3ºC |
| Exact Mass | 216.04200 |
| PSA | 74.60000 |
| LogP | 2.23620 |
| Index of Refraction | 1.708 |
| InChIKey | HRRDCWDFRIJIQZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2cccc(C(=O)O)c12 |
| HS Code | 2917399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Naphthalic acid |
| 1,8-Naphthalic acid |
| 1,8-napththalenedicarboxylic acid |
| 1,8-naphthalene-dicarboxylic acid |