2-(Carboxycarbonyl)benzoic acid
2-(Carboxycarbonyl)benzoic acid structure
|
Common Name | 2-(Carboxycarbonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 528-46-1 | Molecular Weight | 194.14100 | |
| Density | 1.515g/cm3 | Boiling Point | 406.1ºC at 760mmHg | |
| Molecular Formula | C9H6O5 | Melting Point | 140 °C | |
| MSDS | N/A | Flash Point | 213.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Carboxycarbonyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.515g/cm3 |
|---|---|
| Boiling Point | 406.1ºC at 760mmHg |
| Melting Point | 140 °C |
| Molecular Formula | C9H6O5 |
| Molecular Weight | 194.14100 |
| Flash Point | 213.6ºC |
| Exact Mass | 194.02200 |
| PSA | 91.67000 |
| LogP | 0.65210 |
| Index of Refraction | 1.616 |
| InChIKey | LFLOMAIEONDOLV-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)c1ccccc1C(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918300090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 10 | |
CAS#:91-20-3
CAS#:201230-82-2
CAS#:583-53-9
CAS#:88-65-3
CAS#:88-67-5
CAS#:118-91-2
CAS#:694-80-4
CAS#:95-50-1
CAS#:89-51-0
CAS#:485-47-2
CAS#:3260-44-4
CAS#:509-34-2
CAS#:41513-78-4
CAS#:85-44-9
CAS#:65543-72-8
CAS#:119-67-5
CAS#:2852-91-7
CAS#:703-59-3
CAS#:2881-31-4This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibitory activity against Yersinia Protein-tyrosine phosphatase 1B
Source: ChEMBL
Target: Tyrosine-protein phosphatase non-receptor type 1
External Id: CHEMBL770117
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-oxalobenzoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(Carboxycarbonyl)benzoic acid? |
| A: InChIKey of 2-(Carboxycarbonyl)benzoic acid is LFLOMAIEONDOLV-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 2-(Carboxycarbonyl)benzoic acid? |
| A: Related upstream materials(CAS) of 2-(Carboxycarbonyl)benzoic acid: 91-20-3;201230-82-2;583-53-9;88-65-3;88-67-5;118-91-2;694-80-4;95-50-1;89-51-0;485-47-2. |
| Q: What is the molecular formula of 2-(Carboxycarbonyl)benzoic acid? |
| A: Molecular formula of 2-(Carboxycarbonyl)benzoic acid is C9H6O5. |
| Q: What is the LogP of 2-(Carboxycarbonyl)benzoic acid? |
| A: LogP of 2-(Carboxycarbonyl)benzoic acid is 0.65210. |
| Q: What is the melting point of 2-(Carboxycarbonyl)benzoic acid? |
| A: Melting point of 2-(Carboxycarbonyl)benzoic acid is 140 °C. |
| Q: What are the downstream products of 2-(Carboxycarbonyl)benzoic acid? |
| A: Related downstream products(CAS) of 2-(Carboxycarbonyl)benzoic acid: 3260-44-4;509-34-2;41513-78-4;85-44-9;65543-72-8;119-67-5;2852-91-7;89-51-0;703-59-3;2881-31-4. |
| Q: What is the polar surface area (PSA) of 2-(Carboxycarbonyl)benzoic acid? |
| A: Polar surface area (PSA) of 2-(Carboxycarbonyl)benzoic acid is 91.67000. |
| Q: What is the molecular weight of 2-(Carboxycarbonyl)benzoic acid? |
| A: Molecular weight of 2-(Carboxycarbonyl)benzoic acid is 194.14100. |
| Q: What is the boiling point of 2-(Carboxycarbonyl)benzoic acid? |
| A: Boiling point of 2-(Carboxycarbonyl)benzoic acid is 406.1ºC at 760mmHg. |
| Q: What is the CAS number of 2-(Carboxycarbonyl)benzoic acid? |
| A: CAS number of 2-(Carboxycarbonyl)benzoic acid is 528-46-1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |