2-(Carboxycarbonyl)benzoic acid structure
|
Common Name | 2-(Carboxycarbonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 528-46-1 | Molecular Weight | 194.14100 | |
| Density | 1.515g/cm3 | Boiling Point | 406.1ºC at 760mmHg | |
| Molecular Formula | C9H6O5 | Melting Point | 140 °C | |
| MSDS | N/A | Flash Point | 213.6ºC | |
| Name | 2-(Carboxycarbonyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.515g/cm3 |
|---|---|
| Boiling Point | 406.1ºC at 760mmHg |
| Melting Point | 140 °C |
| Molecular Formula | C9H6O5 |
| Molecular Weight | 194.14100 |
| Flash Point | 213.6ºC |
| Exact Mass | 194.02200 |
| PSA | 91.67000 |
| LogP | 0.65210 |
| Index of Refraction | 1.616 |
| InChIKey | LFLOMAIEONDOLV-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)c1ccccc1C(=O)O |
| HS Code | 2918300090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: Inhibitory activity against Yersinia Protein-tyrosine phosphatase 1B
Source: ChEMBL
Target: Tyrosine-protein phosphatase non-receptor type 1
External Id: CHEMBL770117
|
| 2-oxalobenzoic acid |